C30H33N5O6S — CID 153301888
S-[[(4R,6S,6aR)-4-[6-[[4-[(4-methoxyphenyl)methoxy]phenyl]methylamino]purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl] ethanethioate (PubChem CID 153301888) has the molecular formula C30H33N5O6S and a molecular weight of 591.69 g/mol. Its IUPAC name is S-[[(4R,6S,6aR)-4-[6-[[4-[(4-methoxyphenyl)methoxy]phenyl]methylamino]purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl] ethanethioate.
| Compound Name | S-[[(4R,6S,6aR)-4-[6-[[4-[(4-methoxyphenyl)methoxy]phenyl]methylamino]purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 153301888 |
| Molecular Formula | C30H33N5O6S |
| Molecular Weight | 591.69 g/mol |
| Exact Mass | 591.22 |
| IUPAC Name | S-[[(4R,6S,6aR)-4-[6-[[4-[(4-methoxyphenyl)methoxy]phenyl]methylamino]purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl] ethanethioate |
| SMILES | COc1ccc(COc2ccc(CNc3ncnc4c3ncn4[C@@H]3O[C@H](CSC(C)=O)[C@@H]4OC(C)(C)OC43)cc2)cc1 |
| InChI | InChI=1S/C30H33N5O6S/c1-18(36)42-15-23-25-26(41-30(2,3)40-25)29(39-23)35-17-34-24-27(32-16-33-28(24)35)31-13-19-5-11-22(12-6-19)38-14-20-7-9-21(37-4)10-8-20/h5-12,16-17,23,25-26,29H,13-15H2,1-4H3,(H,31,32,33)/t23-,25+,26?,29-/m1/s1 |
| InChIKey | WHPFNYZKELSZCL-ZNEGPSOXSA-N |
| XLogP | 4.72 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.69 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|