C34H38N6O8 — CID 160633762
[4-[[[9-[(3aS,4R,6R)-2,2-dimethyl-6-[[(3S)-2-methyl-4-oxopentan-3-yl]carbamoyloxymethyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]amino]methyl]phenyl] benzoate (PubChem CID 160633762) has the molecular formula C34H38N6O8 and a molecular weight of 658.71 g/mol. Its IUPAC name is [4-[[[9-[(3aS,4R,6R)-2,2-dimethyl-6-[[(3S)-2-methyl-4-oxopentan-3-yl]carbamoyloxymethyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]amino]methyl]phenyl] benzoate.
| Compound Name | [4-[[[9-[(3aS,4R,6R)-2,2-dimethyl-6-[[(3S)-2-methyl-4-oxopentan-3-yl]carbamoyloxymethyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]amino]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 160633762 |
| Molecular Formula | C34H38N6O8 |
| Molecular Weight | 658.71 g/mol |
| Exact Mass | 658.28 |
| IUPAC Name | [4-[[[9-[(3aS,4R,6R)-2,2-dimethyl-6-[[(3S)-2-methyl-4-oxopentan-3-yl]carbamoyloxymethyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]amino]methyl]phenyl] benzoate |
| SMILES | CC(=O)[C@@H](NC(=O)OC[C@H]1O[C@@H](n2cnc3c(NCc4ccc(OC(=O)c5ccccc5)cc4)ncnc32)[C@H]2OC(C)(C)OC12)C(C)C |
| InChI | InChI=1S/C34H38N6O8/c1-19(2)25(20(3)41)39-33(43)44-16-24-27-28(48-34(4,5)47-27)31(46-24)40-18-38-26-29(36-17-37-30(26)40)35-15-21-11-13-23(14-12-21)45-32(42)22-9-7-6-8-10-22/h6-14,17-19,24-25,27-28,31H,15-16H2,1-5H3,(H,39,43)(H,35,36,37)/t24-,25+,27?,28+,31-/m1/s1 |
| InChIKey | RIGLNBVZCWXXFB-XHLHTKLOSA-N |
| XLogP | 4.41 |
| TPSA | 165.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.71 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|