C25H29N5O8S — CID 135271615
methyl 2-[[4-[6-[(4-methoxyphenyl)methylsulfanyl]purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxycarbonylamino]acetate (PubChem CID 135271615) has the molecular formula C25H29N5O8S and a molecular weight of 559.60 g/mol. Its IUPAC name is methyl 2-[[4-[6-[(4-methoxyphenyl)methylsulfanyl]purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxycarbonylamino]acetate.
| Compound Name | methyl 2-[[4-[6-[(4-methoxyphenyl)methylsulfanyl]purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxycarbonylamino]acetate |
|---|---|
| PubChem CID | 135271615 |
| Molecular Formula | C25H29N5O8S |
| Molecular Weight | 559.60 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | methyl 2-[[4-[6-[(4-methoxyphenyl)methylsulfanyl]purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxycarbonylamino]acetate |
| SMILES | COC(=O)CNC(=O)OCC1OC(n2cnc3c(SCc4ccc(OC)cc4)ncnc32)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C25H29N5O8S/c1-25(2)37-19-16(10-35-24(32)26-9-17(31)34-4)36-23(20(19)38-25)30-13-29-18-21(30)27-12-28-22(18)39-11-14-5-7-15(33-3)8-6-14/h5-8,12-13,16,19-20,23H,9-11H2,1-4H3,(H,26,32) |
| InChIKey | IJIJUJLOSTXQNG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.60 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |