C25H31N5O6 — CID 68931555
[(3aR,4R,6S,6aS)-4-(6-amino-2-cyclopentyloxypurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-phenylmethoxymethanol (PubChem CID 68931555) has the molecular formula C25H31N5O6 and a molecular weight of 497.55 g/mol. Its IUPAC name is [(3aR,4R,6S,6aS)-4-(6-amino-2-cyclopentyloxypurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-phenylmethoxymethanol.
| Compound Name | [(3aR,4R,6S,6aS)-4-(6-amino-2-cyclopentyloxypurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-phenylmethoxymethanol |
|---|---|
| PubChem CID | 68931555 |
| Molecular Formula | C25H31N5O6 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | [(3aR,4R,6S,6aS)-4-(6-amino-2-cyclopentyloxypurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-phenylmethoxymethanol |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](C(O)OCc1ccccc1)O[C@H]2n1cnc2c(N)nc(OC3CCCC3)nc21 |
| InChI | InChI=1S/C25H31N5O6/c1-25(2)35-17-18(36-25)22(34-19(17)23(31)32-12-14-8-4-3-5-9-14)30-13-27-16-20(26)28-24(29-21(16)30)33-15-10-6-7-11-15/h3-5,8-9,13,15,17-19,22-23,31H,6-7,10-12H2,1-2H3,(H2,26,28,29)/t17-,18+,19-,22+,23?/m0/s1 |
| InChIKey | SVJXSQBXGNVSPE-WNDLGHPXSA-N |
| XLogP | 2.68 |
| TPSA | 136.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|