C41H44N6O9 — CID 23254999
dibenzyl 2-[4-[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-3-(phenylmethoxycarbonylamino)butyl]propanedioate (PubChem CID 23254999) has the molecular formula C41H44N6O9 and a molecular weight of 764.84 g/mol. Its IUPAC name is dibenzyl 2-[4-[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-3-(phenylmethoxycarbonylamino)butyl]propanedioate.
| Compound Name | dibenzyl 2-[4-[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-3-(phenylmethoxycarbonylamino)butyl]propanedioate |
|---|---|
| PubChem CID | 23254999 |
| Molecular Formula | C41H44N6O9 |
| Molecular Weight | 764.84 g/mol |
| Exact Mass | 764.32 |
| IUPAC Name | dibenzyl 2-[4-[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-3-(phenylmethoxycarbonylamino)butyl]propanedioate |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CC(CCC(C(=O)OCc1ccccc1)C(=O)OCc1ccccc1)NC(=O)OCc1ccccc1)O[C@H]2n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C41H44N6O9/c1-41(2)55-33-31(54-37(34(33)56-41)47-25-45-32-35(42)43-24-44-36(32)47)20-29(46-40(50)53-23-28-16-10-5-11-17-28)18-19-30(38(48)51-21-26-12-6-3-7-13-26)39(49)52-22-27-14-8-4-9-15-27/h3-17,24-25,29-31,33-34,37H,18-23H2,1-2H3,(H,46,50)(H2,42,43,44)/t29?,31-,33-,34-,37-/m1/s1 |
| InChIKey | RRESTCVASWVZSA-GTNCURKHSA-N |
| XLogP | 5.39 |
| TPSA | 188.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.84 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|