C31H45N7O5 — CID 66805534
tert-butyl N-[(2R)-4-[[(4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-propylamino]-1-phenylbutan-2-yl]carbamate (PubChem CID 66805534) has the molecular formula C31H45N7O5 and a molecular weight of 595.75 g/mol. Its IUPAC name is tert-butyl N-[(2R)-4-[[(4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-propylamino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-4-[[(4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-propylamino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 66805534 |
| Molecular Formula | C31H45N7O5 |
| Molecular Weight | 595.75 g/mol |
| Exact Mass | 595.35 |
| IUPAC Name | tert-butyl N-[(2R)-4-[[(4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-propylamino]-1-phenylbutan-2-yl]carbamate |
| SMILES | CCCN(CC[C@@H](Cc1ccccc1)NC(=O)OC(C)(C)C)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)C2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C31H45N7O5/c1-7-14-37(15-13-21(16-20-11-9-8-10-12-20)36-29(39)43-30(2,3)4)17-22-24-25(42-31(5,6)41-24)28(40-22)38-19-35-23-26(32)33-18-34-27(23)38/h8-12,18-19,21-22,24-25,28H,7,13-17H2,1-6H3,(H,36,39)(H2,32,33,34)/t21-,22+,24+,25?,28+/m0/s1 |
| InChIKey | AYQKLXDJHWIHDE-GBBDIYQMSA-N |
| XLogP | 4.06 |
| TPSA | 138.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.75 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |