C22H27N5O4 — CID 68934015
(2R,3R,4S,5R)-2-(6-amino-2-cyclopentyloxypurin-9-yl)-5-methyl-4-phenylmethoxyoxolan-3-ol (PubChem CID 68934015) has the molecular formula C22H27N5O4 and a molecular weight of 425.49 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-amino-2-cyclopentyloxypurin-9-yl)-5-methyl-4-phenylmethoxyoxolan-3-ol.
| Compound Name | (2R,3R,4S,5R)-2-(6-amino-2-cyclopentyloxypurin-9-yl)-5-methyl-4-phenylmethoxyoxolan-3-ol |
|---|---|
| PubChem CID | 68934015 |
| Molecular Formula | C22H27N5O4 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-amino-2-cyclopentyloxypurin-9-yl)-5-methyl-4-phenylmethoxyoxolan-3-ol |
| SMILES | C[C@H]1O[C@@H](n2cnc3c(N)nc(OC4CCCC4)nc32)[C@H](O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H27N5O4/c1-13-18(29-11-14-7-3-2-4-8-14)17(28)21(30-13)27-12-24-16-19(23)25-22(26-20(16)27)31-15-9-5-6-10-15/h2-4,7-8,12-13,15,17-18,21,28H,5-6,9-11H2,1H3,(H2,23,25,26)/t13-,17-,18-,21-/m1/s1 |
| InChIKey | PZMLJEQYHJEBTL-RAXVHSSMSA-N |
| XLogP | 2.59 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |