C17H25N5O5S — CID 68933568
(3S,4R,5R)-2-(6-amino-2-cyclopentyloxypurin-9-yl)-4-ethylsulfonyl-5-methyloxolan-3-ol (PubChem CID 68933568) has the molecular formula C17H25N5O5S and a molecular weight of 411.48 g/mol. Its IUPAC name is (3S,4R,5R)-2-(6-amino-2-cyclopentyloxypurin-9-yl)-4-ethylsulfonyl-5-methyloxolan-3-ol.
| Compound Name | (3S,4R,5R)-2-(6-amino-2-cyclopentyloxypurin-9-yl)-4-ethylsulfonyl-5-methyloxolan-3-ol |
|---|---|
| PubChem CID | 68933568 |
| Molecular Formula | C17H25N5O5S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | (3S,4R,5R)-2-(6-amino-2-cyclopentyloxypurin-9-yl)-4-ethylsulfonyl-5-methyloxolan-3-ol |
| SMILES | CCS(=O)(=O)[C@H]1[C@@H](C)OC(n2cnc3c(N)nc(OC4CCCC4)nc32)[C@@H]1O |
| InChI | InChI=1S/C17H25N5O5S/c1-3-28(24,25)13-9(2)26-16(12(13)23)22-8-19-11-14(18)20-17(21-15(11)22)27-10-6-4-5-7-10/h8-10,12-13,16,23H,3-7H2,1-2H3,(H2,18,20,21)/t9-,12-,13+,16?/m1/s1 |
| InChIKey | JXJCBEJIQIQOKI-DZJXOQQYSA-N |
| XLogP | 0.81 |
| TPSA | 142.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |