C12H16N4O3 — CID 46181793
(2R,3S,4S,6R)-2-methyl-6-(6-methylpurin-9-yl)oxane-3,4-diol (PubChem CID 46181793) has the molecular formula C12H16N4O3 and a molecular weight of 264.29 g/mol. Its IUPAC name is (2R,3S,4S,6R)-2-methyl-6-(6-methylpurin-9-yl)oxane-3,4-diol.
| Compound Name | (2R,3S,4S,6R)-2-methyl-6-(6-methylpurin-9-yl)oxane-3,4-diol |
|---|---|
| PubChem CID | 46181793 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (2R,3S,4S,6R)-2-methyl-6-(6-methylpurin-9-yl)oxane-3,4-diol |
| SMILES | Cc1ncnc2c1ncn2[C@H]1C[C@H](O)[C@H](O)[C@@H](C)O1 |
| InChI | InChI=1S/C12H16N4O3/c1-6-10-12(14-4-13-6)16(5-15-10)9-3-8(17)11(18)7(2)19-9/h4-5,7-9,11,17-18H,3H2,1-2H3/t7-,8+,9-,11-/m1/s1 |
| InChIKey | VFQOMZOQYYHVLJ-PKIKSRDPSA-N |
| XLogP | 0.16 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |