C13H16N4O2 — CID 163826997
(2S,3aR,6R,6aS)-2-(6-methylpurin-9-yl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-6-ol (PubChem CID 163826997) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is (2S,3aR,6R,6aS)-2-(6-methylpurin-9-yl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-6-ol.
| Compound Name | (2S,3aR,6R,6aS)-2-(6-methylpurin-9-yl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-6-ol |
|---|---|
| PubChem CID | 163826997 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (2S,3aR,6R,6aS)-2-(6-methylpurin-9-yl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-6-ol |
| SMILES | Cc1ncnc2c1ncn2[C@@H]1C[C@H]2CC[C@@H](O)[C@H]2O1 |
| InChI | InChI=1S/C13H16N4O2/c1-7-11-13(15-5-14-7)17(6-16-11)10-4-8-2-3-9(18)12(8)19-10/h5-6,8-10,12,18H,2-4H2,1H3/t8-,9-,10+,12+/m1/s1 |
| InChIKey | OAIKMABPNUWACD-SVDPJWKOSA-N |
| XLogP | 1.19 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |