C11H15N5O2 — CID 58834008
[(2S,3R,5R)-3-amino-5-(6-methylpurin-9-yl)oxolan-2-yl]methanol (PubChem CID 58834008) has the molecular formula C11H15N5O2 and a molecular weight of 249.27 g/mol. Its IUPAC name is [(2S,3R,5R)-3-amino-5-(6-methylpurin-9-yl)oxolan-2-yl]methanol.
| Compound Name | [(2S,3R,5R)-3-amino-5-(6-methylpurin-9-yl)oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 58834008 |
| Molecular Formula | C11H15N5O2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | [(2S,3R,5R)-3-amino-5-(6-methylpurin-9-yl)oxolan-2-yl]methanol |
| SMILES | Cc1ncnc2c1ncn2[C@H]1C[C@@H](N)[C@@H](CO)O1 |
| InChI | InChI=1S/C11H15N5O2/c1-6-10-11(14-4-13-6)16(5-15-10)9-2-7(12)8(3-17)18-9/h4-5,7-9,17H,2-3,12H2,1H3/t7-,8-,9-/m1/s1 |
| InChIKey | DFZSASZFAZXPQR-IWSPIJDZSA-N |
| XLogP | -0.26 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |