C13H14N4O3S — CID 69219762
(2R,3R,4S,5S)-2-(6-methylpurin-9-yl)-5-(2H-thiet-2-yl)oxolane-3,4-diol (PubChem CID 69219762) has the molecular formula C13H14N4O3S and a molecular weight of 306.35 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-(6-methylpurin-9-yl)-5-(2H-thiet-2-yl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-(6-methylpurin-9-yl)-5-(2H-thiet-2-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 69219762 |
| Molecular Formula | C13H14N4O3S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | (2R,3R,4S,5S)-2-(6-methylpurin-9-yl)-5-(2H-thiet-2-yl)oxolane-3,4-diol |
| SMILES | Cc1ncnc2c1ncn2[C@@H]1O[C@H](C2C=CS2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H14N4O3S/c1-6-8-12(15-4-14-6)17(5-16-8)13-10(19)9(18)11(20-13)7-2-3-21-7/h2-5,7,9-11,13,18-19H,1H3/t7?,9-,10+,11+,13+/m0/s1 |
| InChIKey | CAUQHBGVYNVHFJ-NQHHDDJASA-N |
| XLogP | 0.38 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |