C11H12N4O2 — CID 59380884
[5-(6-methylpurin-9-yl)-2,5-dihydrofuran-2-yl]methanol (PubChem CID 59380884) has the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. Its IUPAC name is [5-(6-methylpurin-9-yl)-2,5-dihydrofuran-2-yl]methanol.
| Compound Name | [5-(6-methylpurin-9-yl)-2,5-dihydrofuran-2-yl]methanol |
|---|---|
| PubChem CID | 59380884 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | [5-(6-methylpurin-9-yl)-2,5-dihydrofuran-2-yl]methanol |
| SMILES | Cc1ncnc2c1ncn2C1C=CC(CO)O1 |
| InChI | InChI=1S/C11H12N4O2/c1-7-10-11(13-5-12-7)15(6-14-10)9-3-2-8(4-16)17-9/h2-3,5-6,8-9,16H,4H2,1H3 |
| InChIKey | ZXJIVGNTXNIZFV-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|