C12H14N6O2 — CID 56967780
[(2S,5R)-5-[2-amino-6-(aziridin-1-yl)purin-9-yl]-2,5-dihydrofuran-2-yl]methanol (PubChem CID 56967780) has the molecular formula C12H14N6O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is [(2S,5R)-5-[2-amino-6-(aziridin-1-yl)purin-9-yl]-2,5-dihydrofuran-2-yl]methanol.
| Compound Name | [(2S,5R)-5-[2-amino-6-(aziridin-1-yl)purin-9-yl]-2,5-dihydrofuran-2-yl]methanol |
|---|---|
| PubChem CID | 56967780 |
| Molecular Formula | C12H14N6O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | [(2S,5R)-5-[2-amino-6-(aziridin-1-yl)purin-9-yl]-2,5-dihydrofuran-2-yl]methanol |
| SMILES | Nc1nc(N2CC2)c2ncn([C@H]3C=C[C@@H](CO)O3)c2n1 |
| InChI | InChI=1S/C12H14N6O2/c13-12-15-10(17-3-4-17)9-11(16-12)18(6-14-9)8-2-1-7(5-19)20-8/h1-2,6-8,19H,3-5H2,(H2,13,15,16)/t7-,8+/m0/s1 |
| InChIKey | OKHCZLWXKDBOMS-JGVFFNPUSA-N |
| XLogP | -0.33 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|