C10H10FN5O2 — CID 15172904
[(2R,5S)-5-(6-amino-2-fluoropurin-9-yl)-2,5-dihydrofuran-2-yl]methanol (PubChem CID 15172904) has the molecular formula C10H10FN5O2 and a molecular weight of 251.22 g/mol. Its IUPAC name is [(2R,5S)-5-(6-amino-2-fluoropurin-9-yl)-2,5-dihydrofuran-2-yl]methanol.
| Compound Name | [(2R,5S)-5-(6-amino-2-fluoropurin-9-yl)-2,5-dihydrofuran-2-yl]methanol |
|---|---|
| PubChem CID | 15172904 |
| Molecular Formula | C10H10FN5O2 |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | [(2R,5S)-5-(6-amino-2-fluoropurin-9-yl)-2,5-dihydrofuran-2-yl]methanol |
| SMILES | Nc1nc(F)nc2c1ncn2[C@@H]1C=C[C@H](CO)O1 |
| InChI | InChI=1S/C10H10FN5O2/c11-10-14-8(12)7-9(15-10)16(4-13-7)6-2-1-5(3-17)18-6/h1-2,4-6,17H,3H2,(H2,12,14,15)/t5-,6+/m1/s1 |
| InChIKey | SHCSZSMHKRQFLU-RITPCOANSA-N |
| XLogP | -0.01 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|