C14H21N7O3 — CID 77147039
4-amino-5-[2-amino-6-(azetidin-1-yl)purin-9-yl]-2-(hydroxymethyl)-4-methyloxolan-3-ol (PubChem CID 77147039) has the molecular formula C14H21N7O3 and a molecular weight of 335.37 g/mol. Its IUPAC name is 4-amino-5-[2-amino-6-(azetidin-1-yl)purin-9-yl]-2-(hydroxymethyl)-4-methyloxolan-3-ol.
| Compound Name | 4-amino-5-[2-amino-6-(azetidin-1-yl)purin-9-yl]-2-(hydroxymethyl)-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 77147039 |
| Molecular Formula | C14H21N7O3 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 4-amino-5-[2-amino-6-(azetidin-1-yl)purin-9-yl]-2-(hydroxymethyl)-4-methyloxolan-3-ol |
| SMILES | CC1(N)C(O)C(CO)OC1n1cnc2c(N3CCC3)nc(N)nc21 |
| InChI | InChI=1S/C14H21N7O3/c1-14(16)9(23)7(5-22)24-12(14)21-6-17-8-10(20-3-2-4-20)18-13(15)19-11(8)21/h6-7,9,12,22-23H,2-5,16H2,1H3,(H2,15,18,19) |
| InChIKey | JPXBKNCFDSMMLU-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 148.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |