C24H33N8O7P — CID 66576577
methyl (2S)-2-[[[(2R,3S,4R,5R)-4-amino-5-[2-amino-6-(azetidin-1-yl)purin-9-yl]-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 66576577) has the molecular formula C24H33N8O7P and a molecular weight of 576.55 g/mol. Its IUPAC name is methyl (2S)-2-[[[(2R,3S,4R,5R)-4-amino-5-[2-amino-6-(azetidin-1-yl)purin-9-yl]-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[(2R,3S,4R,5R)-4-amino-5-[2-amino-6-(azetidin-1-yl)purin-9-yl]-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 66576577 |
| Molecular Formula | C24H33N8O7P |
| Molecular Weight | 576.55 g/mol |
| Exact Mass | 576.22 |
| IUPAC Name | methyl (2S)-2-[[[(2R,3S,4R,5R)-4-amino-5-[2-amino-6-(azetidin-1-yl)purin-9-yl]-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2cnc3c(N4CCC4)nc(N)nc32)[C@](C)(N)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C24H33N8O7P/c1-14(21(34)36-3)30-40(35,39-15-8-5-4-6-9-15)37-12-16-18(33)24(2,26)22(38-16)32-13-27-17-19(31-10-7-11-31)28-23(25)29-20(17)32/h4-6,8-9,13-14,16,18,22,33H,7,10-12,26H2,1-3H3,(H,30,35)(H2,25,28,29)/t14-,16+,18+,22+,24+,40?/m0/s1 |
| InChIKey | PGPQXPONKBUXLJ-HEOQURLSSA-N |
| XLogP | 0.95 |
| TPSA | 202.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.55 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|