C11H13N5OS — CID 59949014
[(2S)-5-[6-(methylamino)purin-9-yl]-2,5-dihydrofuran-2-yl]methanethiol (PubChem CID 59949014) has the molecular formula C11H13N5OS and a molecular weight of 263.33 g/mol. Its IUPAC name is [(2S)-5-[6-(methylamino)purin-9-yl]-2,5-dihydrofuran-2-yl]methanethiol.
| Compound Name | [(2S)-5-[6-(methylamino)purin-9-yl]-2,5-dihydrofuran-2-yl]methanethiol |
|---|---|
| PubChem CID | 59949014 |
| Molecular Formula | C11H13N5OS |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | [(2S)-5-[6-(methylamino)purin-9-yl]-2,5-dihydrofuran-2-yl]methanethiol |
| SMILES | CNc1ncnc2c1ncn2C1C=C[C@@H](CS)O1 |
| InChI | InChI=1S/C11H13N5OS/c1-12-10-9-11(14-5-13-10)16(6-15-9)8-3-2-7(4-18)17-8/h2-3,5-8,18H,4H2,1H3,(H,12,13,14)/t7-,8?/m0/s1 |
| InChIKey | LQJXJWCWNKMCQD-JAMMHHFISA-N |
| XLogP | 1.25 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|