C18H19N5O2 — CID 57103058
[(2S,5R)-5-[6-[(2-methylphenyl)methylamino]purin-9-yl]-2,5-dihydrofuran-2-yl]methanol (PubChem CID 57103058) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is [(2S,5R)-5-[6-[(2-methylphenyl)methylamino]purin-9-yl]-2,5-dihydrofuran-2-yl]methanol.
| Compound Name | [(2S,5R)-5-[6-[(2-methylphenyl)methylamino]purin-9-yl]-2,5-dihydrofuran-2-yl]methanol |
|---|---|
| PubChem CID | 57103058 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | [(2S,5R)-5-[6-[(2-methylphenyl)methylamino]purin-9-yl]-2,5-dihydrofuran-2-yl]methanol |
| SMILES | Cc1ccccc1CNc1ncnc2c1ncn2[C@H]1C=C[C@@H](CO)O1 |
| InChI | InChI=1S/C18H19N5O2/c1-12-4-2-3-5-13(12)8-19-17-16-18(21-10-20-17)23(11-22-16)15-7-6-14(9-24)25-15/h2-7,10-11,14-15,24H,8-9H2,1H3,(H,19,20,21)/t14-,15+/m0/s1 |
| InChIKey | SIEKCVXSESMBGY-LSDHHAIUSA-N |
| XLogP | 2.19 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|