C16H22N4O5 — CID 166955749
2-(hydroxymethyl)-5-(6-methylpurin-9-yl)-4-(2-prop-2-enoxyethoxy)oxolan-3-ol (PubChem CID 166955749) has the molecular formula C16H22N4O5 and a molecular weight of 350.38 g/mol. Its IUPAC name is 2-(hydroxymethyl)-5-(6-methylpurin-9-yl)-4-(2-prop-2-enoxyethoxy)oxolan-3-ol.
| Compound Name | 2-(hydroxymethyl)-5-(6-methylpurin-9-yl)-4-(2-prop-2-enoxyethoxy)oxolan-3-ol |
|---|---|
| PubChem CID | 166955749 |
| Molecular Formula | C16H22N4O5 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 2-(hydroxymethyl)-5-(6-methylpurin-9-yl)-4-(2-prop-2-enoxyethoxy)oxolan-3-ol |
| SMILES | C=CCOCCOC1C(O)C(CO)OC1n1cnc2c(C)ncnc21 |
| InChI | InChI=1S/C16H22N4O5/c1-3-4-23-5-6-24-14-13(22)11(7-21)25-16(14)20-9-19-12-10(2)17-8-18-15(12)20/h3,8-9,11,13-14,16,21-22H,1,4-7H2,2H3 |
| InChIKey | ZWGXKLVGTYUXDC-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 111.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|