C13H15FN4O4 — CID 167072676
(4R)-4-fluoro-2-(hydroxymethyl)-5-(6-prop-2-enoxypurin-9-yl)oxolan-3-ol (PubChem CID 167072676) has the molecular formula C13H15FN4O4 and a molecular weight of 310.29 g/mol. Its IUPAC name is (4R)-4-fluoro-2-(hydroxymethyl)-5-(6-prop-2-enoxypurin-9-yl)oxolan-3-ol.
| Compound Name | (4R)-4-fluoro-2-(hydroxymethyl)-5-(6-prop-2-enoxypurin-9-yl)oxolan-3-ol |
|---|---|
| PubChem CID | 167072676 |
| Molecular Formula | C13H15FN4O4 |
| Molecular Weight | 310.29 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | (4R)-4-fluoro-2-(hydroxymethyl)-5-(6-prop-2-enoxypurin-9-yl)oxolan-3-ol |
| SMILES | C=CCOc1ncnc2c1ncn2C1OC(CO)C(O)[C@H]1F |
| InChI | InChI=1S/C13H15FN4O4/c1-2-3-21-12-9-11(15-5-16-12)18(6-17-9)13-8(14)10(20)7(4-19)22-13/h2,5-8,10,13,19-20H,1,3-4H2/t7?,8-,10?,13?/m1/s1 |
| InChIKey | XGKYLEYLSVSNER-CCQSCSKTSA-N |
| XLogP | -0.02 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.29 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|