C13H18N4O5 — CID 21149135
2-(hydroxymethyl)-5-(6-propan-2-yloxypurin-9-yl)oxolane-3,4-diol (PubChem CID 21149135) has the molecular formula C13H18N4O5 and a molecular weight of 310.31 g/mol. Its IUPAC name is 2-(hydroxymethyl)-5-(6-propan-2-yloxypurin-9-yl)oxolane-3,4-diol.
| Compound Name | 2-(hydroxymethyl)-5-(6-propan-2-yloxypurin-9-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 21149135 |
| Molecular Formula | C13H18N4O5 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2-(hydroxymethyl)-5-(6-propan-2-yloxypurin-9-yl)oxolane-3,4-diol |
| SMILES | CC(C)Oc1ncnc2c1ncn2C1OC(CO)C(O)C1O |
| InChI | InChI=1S/C13H18N4O5/c1-6(2)21-12-8-11(14-4-15-12)17(5-16-8)13-10(20)9(19)7(3-18)22-13/h4-7,9-10,13,18-20H,3H2,1-2H3 |
| InChIKey | YWRIQNCIIRTRND-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |