C10H11FN4O3 — CID 56980111
(2R,3R,4R,5R)-4-fluoro-2-(hydroxymethyl)-5-purin-9-yloxolan-3-ol (PubChem CID 56980111) has the molecular formula C10H11FN4O3 and a molecular weight of 254.22 g/mol. Its IUPAC name is (2R,3R,4R,5R)-4-fluoro-2-(hydroxymethyl)-5-purin-9-yloxolan-3-ol.
| Compound Name | (2R,3R,4R,5R)-4-fluoro-2-(hydroxymethyl)-5-purin-9-yloxolan-3-ol |
|---|---|
| PubChem CID | 56980111 |
| Molecular Formula | C10H11FN4O3 |
| Molecular Weight | 254.22 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | (2R,3R,4R,5R)-4-fluoro-2-(hydroxymethyl)-5-purin-9-yloxolan-3-ol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3cncnc32)[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C10H11FN4O3/c11-7-8(17)6(2-16)18-10(7)15-4-14-5-1-12-3-13-9(5)15/h1,3-4,6-8,10,16-17H,2H2/t6-,7-,8-,10-/m1/s1 |
| InChIKey | HLBLWLNFMONEHG-FDDDBJFASA-N |
| XLogP | -0.58 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.22 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |