C11H14FN5O — CID 158052608
[(2S,3R,4R,5R)-4-fluoro-3-methyl-5-purin-9-yloxolan-2-yl]methanamine (PubChem CID 158052608) has the molecular formula C11H14FN5O and a molecular weight of 251.27 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-4-fluoro-3-methyl-5-purin-9-yloxolan-2-yl]methanamine.
| Compound Name | [(2S,3R,4R,5R)-4-fluoro-3-methyl-5-purin-9-yloxolan-2-yl]methanamine |
|---|---|
| PubChem CID | 158052608 |
| Molecular Formula | C11H14FN5O |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | [(2S,3R,4R,5R)-4-fluoro-3-methyl-5-purin-9-yloxolan-2-yl]methanamine |
| SMILES | C[C@H]1[C@@H](F)[C@H](n2cnc3cncnc32)O[C@@H]1CN |
| InChI | InChI=1S/C11H14FN5O/c1-6-8(2-13)18-11(9(6)12)17-5-16-7-3-14-4-15-10(7)17/h3-6,8-9,11H,2,13H2,1H3/t6-,8-,9-,11-/m1/s1 |
| InChIKey | FDURYGSLWOUTBL-PNHWDRBUSA-N |
| XLogP | 0.66 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |