C14H21FN6O — CID 134165908
9-[(2R,3S,4R,5R)-5-ethyl-3-fluoro-4-methyloxolan-2-yl]-6-N,6-N-dimethylpurine-2,6-diamine (PubChem CID 134165908) has the molecular formula C14H21FN6O and a molecular weight of 308.36 g/mol. Its IUPAC name is 9-[(2R,3S,4R,5R)-5-ethyl-3-fluoro-4-methyloxolan-2-yl]-6-N,6-N-dimethylpurine-2,6-diamine.
| Compound Name | 9-[(2R,3S,4R,5R)-5-ethyl-3-fluoro-4-methyloxolan-2-yl]-6-N,6-N-dimethylpurine-2,6-diamine |
|---|---|
| PubChem CID | 134165908 |
| Molecular Formula | C14H21FN6O |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 9-[(2R,3S,4R,5R)-5-ethyl-3-fluoro-4-methyloxolan-2-yl]-6-N,6-N-dimethylpurine-2,6-diamine |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(N(C)C)nc(N)nc32)[C@@H](F)[C@@H]1C |
| InChI | InChI=1S/C14H21FN6O/c1-5-8-7(2)9(15)13(22-8)21-6-17-10-11(20(3)4)18-14(16)19-12(10)21/h6-9,13H,5H2,1-4H3,(H2,16,18,19)/t7-,8-,9+,13-/m1/s1 |
| InChIKey | LKSCDEWCNQWRLT-RVBSWOSCSA-N |
| XLogP | 1.76 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |