C13H18ClN5O — CID 58049084
2-chloro-9-[(2R,4R,5R)-5-ethyl-3,4-dimethyloxolan-2-yl]purin-6-amine (PubChem CID 58049084) has the molecular formula C13H18ClN5O and a molecular weight of 295.77 g/mol. Its IUPAC name is 2-chloro-9-[(2R,4R,5R)-5-ethyl-3,4-dimethyloxolan-2-yl]purin-6-amine.
| Compound Name | 2-chloro-9-[(2R,4R,5R)-5-ethyl-3,4-dimethyloxolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 58049084 |
| Molecular Formula | C13H18ClN5O |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 2-chloro-9-[(2R,4R,5R)-5-ethyl-3,4-dimethyloxolan-2-yl]purin-6-amine |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(N)nc(Cl)nc32)C(C)[C@H]1C |
| InChI | InChI=1S/C13H18ClN5O/c1-4-8-6(2)7(3)12(20-8)19-5-16-9-10(15)17-13(14)18-11(9)19/h5-8,12H,4H2,1-3H3,(H2,15,17,18)/t6-,7?,8-,12-/m1/s1 |
| InChIKey | WPLJONFHVLFYLQ-JRGFLFPUSA-N |
| XLogP | 2.64 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |