C13H18N7O+ — CID 59575455
6-amino-9-[(2R,3R,4S,5R)-5-ethyl-3,4-dimethyloxolan-2-yl]purine-2-diazonium (PubChem CID 59575455) has the molecular formula C13H18N7O+ and a molecular weight of 288.34 g/mol. Its IUPAC name is 6-amino-9-[(2R,3R,4S,5R)-5-ethyl-3,4-dimethyloxolan-2-yl]purine-2-diazonium.
| Compound Name | 6-amino-9-[(2R,3R,4S,5R)-5-ethyl-3,4-dimethyloxolan-2-yl]purine-2-diazonium |
|---|---|
| PubChem CID | 59575455 |
| Molecular Formula | C13H18N7O+ |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 6-amino-9-[(2R,3R,4S,5R)-5-ethyl-3,4-dimethyloxolan-2-yl]purine-2-diazonium |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(N)nc([N+]#N)nc32)[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C13H18N7O/c1-4-8-6(2)7(3)12(21-8)20-5-16-9-10(14)17-13(19-15)18-11(9)20/h5-8,12H,4H2,1-3H3,(H2,14,17,18)/q+1/t6-,7+,8+,12+/m0/s1 |
| InChIKey | TTXXODRUVKBUSB-HIHLCYOISA-N |
| XLogP | 2.47 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|