C13H15ClF3N5O4S — CID 58049075
[(2R,4S,5R)-2-(6-amino-2-chloropurin-9-yl)-5-ethyl-4-methyloxolan-3-yl] trifluoromethanesulfonate (PubChem CID 58049075) has the molecular formula C13H15ClF3N5O4S and a molecular weight of 429.81 g/mol. Its IUPAC name is [(2R,4S,5R)-2-(6-amino-2-chloropurin-9-yl)-5-ethyl-4-methyloxolan-3-yl] trifluoromethanesulfonate.
| Compound Name | [(2R,4S,5R)-2-(6-amino-2-chloropurin-9-yl)-5-ethyl-4-methyloxolan-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58049075 |
| Molecular Formula | C13H15ClF3N5O4S |
| Molecular Weight | 429.81 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | [(2R,4S,5R)-2-(6-amino-2-chloropurin-9-yl)-5-ethyl-4-methyloxolan-3-yl] trifluoromethanesulfonate |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(N)nc(Cl)nc32)C(OS(=O)(=O)C(F)(F)F)[C@H]1C |
| InChI | InChI=1S/C13H15ClF3N5O4S/c1-3-6-5(2)8(26-27(23,24)13(15,16)17)11(25-6)22-4-19-7-9(18)20-12(14)21-10(7)22/h4-6,8,11H,3H2,1-2H3,(H2,18,20,21)/t5-,6+,8?,11+/m0/s1 |
| InChIKey | UUESXJXEJXWHPN-HOYILKIISA-N |
| XLogP | 2.24 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.81 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|