C10H11FN4O2S — CID 54400741
(2R,3S,4S,5R)-4-fluoro-2-(hydroxymethyl)-5-purin-9-ylthiolan-3-ol (PubChem CID 54400741) has the molecular formula C10H11FN4O2S and a molecular weight of 270.29 g/mol. Its IUPAC name is (2R,3S,4S,5R)-4-fluoro-2-(hydroxymethyl)-5-purin-9-ylthiolan-3-ol.
| Compound Name | (2R,3S,4S,5R)-4-fluoro-2-(hydroxymethyl)-5-purin-9-ylthiolan-3-ol |
|---|---|
| PubChem CID | 54400741 |
| Molecular Formula | C10H11FN4O2S |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | (2R,3S,4S,5R)-4-fluoro-2-(hydroxymethyl)-5-purin-9-ylthiolan-3-ol |
| SMILES | OC[C@H]1S[C@@H](n2cnc3cncnc32)[C@@H](F)[C@@H]1O |
| InChI | InChI=1S/C10H11FN4O2S/c11-7-8(17)6(2-16)18-10(7)15-4-14-5-1-12-3-13-9(5)15/h1,3-4,6-8,10,16-17H,2H2/t6-,7+,8-,10-/m1/s1 |
| InChIKey | VNGHQEIJKGMIPH-IBCQBUCCSA-N |
| XLogP | 0.13 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |