C14H18N6O5 — CID 91559286
3-[[(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]oxymethoxy]propanenitrile (PubChem CID 91559286) has the molecular formula C14H18N6O5 and a molecular weight of 350.34 g/mol. Its IUPAC name is 3-[[(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]oxymethoxy]propanenitrile.
| Compound Name | 3-[[(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]oxymethoxy]propanenitrile |
|---|---|
| PubChem CID | 91559286 |
| Molecular Formula | C14H18N6O5 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 3-[[(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]oxymethoxy]propanenitrile |
| SMILES | N#CCCOCO[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C14H18N6O5/c15-2-1-3-23-7-24-11-10(22)8(4-21)25-14(11)20-6-19-9-12(16)17-5-18-13(9)20/h5-6,8,10-11,14,21-22H,1,3-4,7H2,(H2,16,17,18)/t8-,10-,11-,14-/m1/s1 |
| InChIKey | CFITVYNSTRPJBA-IDTAVKCVSA-N |
| XLogP | -1.07 |
| TPSA | 161.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|