C15H22N5O4+ — CID 54195763
[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]-dimethyl-prop-2-enylazanium (PubChem CID 54195763) has the molecular formula C15H22N5O4+ and a molecular weight of 336.37 g/mol. Its IUPAC name is [9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]-dimethyl-prop-2-enylazanium.
| Compound Name | [9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]-dimethyl-prop-2-enylazanium |
|---|---|
| PubChem CID | 54195763 |
| Molecular Formula | C15H22N5O4+ |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | [9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]-dimethyl-prop-2-enylazanium |
| SMILES | C=CC[N+](C)(C)c1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H22N5O4/c1-4-5-20(2,3)14-10-13(16-7-17-14)19(8-18-10)15-12(23)11(22)9(6-21)24-15/h4,7-9,11-12,15,21-23H,1,5-6H2,2-3H3/q+1/t9-,11-,12-,15-/m1/s1 |
| InChIKey | UOXWQSXWXXRSQV-SDBHATRESA-N |
| XLogP | -0.81 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|