C18H15FN4O3 — CID 123273527
(2R,3R,4S,5R)-2-[6-[2-(2-fluorophenyl)ethynyl]purin-9-yl]-5-methyloxolane-3,4-diol (PubChem CID 123273527) has the molecular formula C18H15FN4O3 and a molecular weight of 354.34 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-[2-(2-fluorophenyl)ethynyl]purin-9-yl]-5-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-[2-(2-fluorophenyl)ethynyl]purin-9-yl]-5-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 123273527 |
| Molecular Formula | C18H15FN4O3 |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-[2-(2-fluorophenyl)ethynyl]purin-9-yl]-5-methyloxolane-3,4-diol |
| SMILES | C[C@H]1O[C@@H](n2cnc3c(C#Cc4ccccc4F)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H15FN4O3/c1-10-15(24)16(25)18(26-10)23-9-22-14-13(20-8-21-17(14)23)7-6-11-4-2-3-5-12(11)19/h2-5,8-10,15-16,18,24-25H,1H3/t10-,15-,16-,18-/m1/s1 |
| InChIKey | MFPHPFHCEGAPPY-DUBJGWMJSA-N |
| XLogP | 1.00 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|