C18H14F2N4O3 — CID 123637701
(2R,3R,4S,5R)-2-[6-[2-(2,4-difluorophenyl)ethynyl]purin-9-yl]-5-methyloxolane-3,4-diol (PubChem CID 123637701) has the molecular formula C18H14F2N4O3 and a molecular weight of 372.33 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-[2-(2,4-difluorophenyl)ethynyl]purin-9-yl]-5-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-[2-(2,4-difluorophenyl)ethynyl]purin-9-yl]-5-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 123637701 |
| Molecular Formula | C18H14F2N4O3 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-[2-(2,4-difluorophenyl)ethynyl]purin-9-yl]-5-methyloxolane-3,4-diol |
| SMILES | C[C@H]1O[C@@H](n2cnc3c(C#Cc4ccc(F)cc4F)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H14F2N4O3/c1-9-15(25)16(26)18(27-9)24-8-23-14-13(21-7-22-17(14)24)5-3-10-2-4-11(19)6-12(10)20/h2,4,6-9,15-16,18,25-26H,1H3/t9-,15-,16-,18-/m1/s1 |
| InChIKey | ORMIGSVXVSVCRU-SMGXOBOGSA-N |
| XLogP | 1.14 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|