C18H16FN5O3 — CID 10177111
(2R,3S,4R,5R)-2-ethynyl-5-[6-(4-fluoro-2-methylanilino)purin-9-yl]oxolane-3,4-diol (PubChem CID 10177111) has the molecular formula C18H16FN5O3 and a molecular weight of 369.36 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-ethynyl-5-[6-(4-fluoro-2-methylanilino)purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-ethynyl-5-[6-(4-fluoro-2-methylanilino)purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 10177111 |
| Molecular Formula | C18H16FN5O3 |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | (2R,3S,4R,5R)-2-ethynyl-5-[6-(4-fluoro-2-methylanilino)purin-9-yl]oxolane-3,4-diol |
| SMILES | C#C[C@H]1O[C@@H](n2cnc3c(Nc4ccc(F)cc4C)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H16FN5O3/c1-3-12-14(25)15(26)18(27-12)24-8-22-13-16(20-7-21-17(13)24)23-11-5-4-10(19)6-9(11)2/h1,4-8,12,14-15,18,25-26H,2H3,(H,20,21,23)/t12-,14-,15-,18-/m1/s1 |
| InChIKey | KKPUVLTWKJMHFS-SCFUHWHPSA-N |
| XLogP | 1.27 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|