C18H17N5O3 — CID 10154931
(2R,3S,4R,5R)-2-ethynyl-5-[6-(4-methylanilino)purin-9-yl]oxolane-3,4-diol (PubChem CID 10154931) has the molecular formula C18H17N5O3 and a molecular weight of 351.37 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-ethynyl-5-[6-(4-methylanilino)purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-ethynyl-5-[6-(4-methylanilino)purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 10154931 |
| Molecular Formula | C18H17N5O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | (2R,3S,4R,5R)-2-ethynyl-5-[6-(4-methylanilino)purin-9-yl]oxolane-3,4-diol |
| SMILES | C#C[C@H]1O[C@@H](n2cnc3c(Nc4ccc(C)cc4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H17N5O3/c1-3-12-14(24)15(25)18(26-12)23-9-21-13-16(19-8-20-17(13)23)22-11-6-4-10(2)5-7-11/h1,4-9,12,14-15,18,24-25H,2H3,(H,19,20,22)/t12-,14-,15-,18-/m1/s1 |
| InChIKey | SKZKLBWPOZUDNL-SCFUHWHPSA-N |
| XLogP | 1.13 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|