C18H13BrF3N5O3 — CID 44528512
(2R,3R,4S,5R)-2-[6-[3-bromo-5-(trifluoromethyl)anilino]purin-9-yl]-5-ethynyloxolane-3,4-diol (PubChem CID 44528512) has the molecular formula C18H13BrF3N5O3 and a molecular weight of 484.23 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-[3-bromo-5-(trifluoromethyl)anilino]purin-9-yl]-5-ethynyloxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-[3-bromo-5-(trifluoromethyl)anilino]purin-9-yl]-5-ethynyloxolane-3,4-diol |
|---|---|
| PubChem CID | 44528512 |
| Molecular Formula | C18H13BrF3N5O3 |
| Molecular Weight | 484.23 g/mol |
| Exact Mass | 483.02 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-[3-bromo-5-(trifluoromethyl)anilino]purin-9-yl]-5-ethynyloxolane-3,4-diol |
| SMILES | C#C[C@H]1O[C@@H](n2cnc3c(Nc4cc(Br)cc(C(F)(F)F)c4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H13BrF3N5O3/c1-2-11-13(28)14(29)17(30-11)27-7-25-12-15(23-6-24-16(12)27)26-10-4-8(18(20,21)22)3-9(19)5-10/h1,3-7,11,13-14,17,28-29H,(H,23,24,26)/t11-,13-,14-,17-/m1/s1 |
| InChIKey | GCFZSJUBBHUVOO-LSCFUAHRSA-N |
| XLogP | 2.60 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|