C18H16F3IN6O4 — CID 164562393
(2S,3S,4R,5R)-3,4-dihydroxy-5-[6-(3-iodoanilino)purin-9-yl]-N-(2,2,2-trifluoroethyl)oxolane-2-carboxamide (PubChem CID 164562393) has the molecular formula C18H16F3IN6O4 and a molecular weight of 564.26 g/mol. Its IUPAC name is (2S,3S,4R,5R)-3,4-dihydroxy-5-[6-(3-iodoanilino)purin-9-yl]-N-(2,2,2-trifluoroethyl)oxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-3,4-dihydroxy-5-[6-(3-iodoanilino)purin-9-yl]-N-(2,2,2-trifluoroethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 164562393 |
| Molecular Formula | C18H16F3IN6O4 |
| Molecular Weight | 564.26 g/mol |
| Exact Mass | 564.02 |
| IUPAC Name | (2S,3S,4R,5R)-3,4-dihydroxy-5-[6-(3-iodoanilino)purin-9-yl]-N-(2,2,2-trifluoroethyl)oxolane-2-carboxamide |
| SMILES | O=C(NCC(F)(F)F)[C@H]1O[C@@H](n2cnc3c(Nc4cccc(I)c4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H16F3IN6O4/c19-18(20,21)5-23-16(31)13-11(29)12(30)17(32-13)28-7-26-10-14(24-6-25-15(10)28)27-9-3-1-2-8(22)4-9/h1-4,6-7,11-13,17,29-30H,5H2,(H,23,31)(H,24,25,27)/t11-,12+,13-,17+/m0/s1 |
| InChIKey | LEUMCXZYAGNMMJ-PFHKOEEOSA-N |
| XLogP | 1.47 |
| TPSA | 134.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|