C17H25N7O5 — CID 11795673
(2S,3S,4R,5R)-5-[6-(tert-butylcarbamoylamino)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 11795673) has the molecular formula C17H25N7O5 and a molecular weight of 407.43 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[6-(tert-butylcarbamoylamino)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[6-(tert-butylcarbamoylamino)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 11795673 |
| Molecular Formula | C17H25N7O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | (2S,3S,4R,5R)-5-[6-(tert-butylcarbamoylamino)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NC(=O)NC(C)(C)C)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H25N7O5/c1-5-18-14(27)11-9(25)10(26)15(29-11)24-7-21-8-12(19-6-20-13(8)24)22-16(28)23-17(2,3)4/h6-7,9-11,15,25-26H,5H2,1-4H3,(H,18,27)(H2,19,20,22,23,28)/t9-,10+,11-,15+/m0/s1 |
| InChIKey | MRRBCVYDFJHRNY-BQVMBELUSA-N |
| XLogP | -0.50 |
| TPSA | 163.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |