C20H29N7O5 — CID 10527397
(3aR,4R,6S,6aS)-4-[6-(tert-butylcarbamoylamino)purin-9-yl]-N-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide (PubChem CID 10527397) has the molecular formula C20H29N7O5 and a molecular weight of 447.50 g/mol. Its IUPAC name is (3aR,4R,6S,6aS)-4-[6-(tert-butylcarbamoylamino)purin-9-yl]-N-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide.
| Compound Name | (3aR,4R,6S,6aS)-4-[6-(tert-butylcarbamoylamino)purin-9-yl]-N-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide |
|---|---|
| PubChem CID | 10527397 |
| Molecular Formula | C20H29N7O5 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | (3aR,4R,6S,6aS)-4-[6-(tert-butylcarbamoylamino)purin-9-yl]-N-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NC(=O)NC(C)(C)C)ncnc32)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C20H29N7O5/c1-7-21-16(28)12-11-13(32-20(5,6)31-11)17(30-12)27-9-24-10-14(22-8-23-15(10)27)25-18(29)26-19(2,3)4/h8-9,11-13,17H,7H2,1-6H3,(H,21,28)(H2,22,23,25,26,29)/t11-,12+,13-,17-/m1/s1 |
| InChIKey | BFJLJTXBFCPBNC-IPJQOSJUSA-N |
| XLogP | 1.30 |
| TPSA | 141.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |