C29H32N8O8S — CID 68899695
9-[(3aR,4R,6S,6aS)-6-(ethylcarbamoyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-[[2-(4-methoxy-N-sulfinoanilino)phenyl]carbamoylamino]purine (PubChem CID 68899695) has the molecular formula C29H32N8O8S and a molecular weight of 652.69 g/mol. Its IUPAC name is 9-[(3aR,4R,6S,6aS)-6-(ethylcarbamoyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-[[2-(4-methoxy-N-sulfinoanilino)phenyl]carbamoylamino]purine.
| Compound Name | 9-[(3aR,4R,6S,6aS)-6-(ethylcarbamoyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-[[2-(4-methoxy-N-sulfinoanilino)phenyl]carbamoylamino]purine |
|---|---|
| PubChem CID | 68899695 |
| Molecular Formula | C29H32N8O8S |
| Molecular Weight | 652.69 g/mol |
| Exact Mass | 652.21 |
| IUPAC Name | 9-[(3aR,4R,6S,6aS)-6-(ethylcarbamoyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-[[2-(4-methoxy-N-sulfinoanilino)phenyl]carbamoylamino]purine |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NC(=O)Nc4ccccc4N(c4ccc(OC)cc4)S(=O)O)ncnc32)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C29H32N8O8S/c1-5-30-26(38)22-21-23(45-29(2,3)44-21)27(43-22)36-15-33-20-24(31-14-32-25(20)36)35-28(39)34-18-8-6-7-9-19(18)37(46(40)41)16-10-12-17(42-4)13-11-16/h6-15,21-23,27H,5H2,1-4H3,(H,30,38)(H,40,41)(H2,31,32,34,35,39)/t21-,22+,23-,27-/m1/s1 |
| InChIKey | RRGMCYNPPOWPCP-QSGNWFJVSA-N |
| XLogP | 3.31 |
| TPSA | 191.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.69 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|