C27H34N8O7S — CID 11273532
(3aR,4R,6S,6aS)-4-[6-[[4-(cyclopentylsulfamoyl)phenyl]carbamoylamino]purin-9-yl]-N-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide (PubChem CID 11273532) has the molecular formula C27H34N8O7S and a molecular weight of 614.69 g/mol. Its IUPAC name is (3aR,4R,6S,6aS)-4-[6-[[4-(cyclopentylsulfamoyl)phenyl]carbamoylamino]purin-9-yl]-N-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide.
| Compound Name | (3aR,4R,6S,6aS)-4-[6-[[4-(cyclopentylsulfamoyl)phenyl]carbamoylamino]purin-9-yl]-N-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide |
|---|---|
| PubChem CID | 11273532 |
| Molecular Formula | C27H34N8O7S |
| Molecular Weight | 614.69 g/mol |
| Exact Mass | 614.23 |
| IUPAC Name | (3aR,4R,6S,6aS)-4-[6-[[4-(cyclopentylsulfamoyl)phenyl]carbamoylamino]purin-9-yl]-N-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NC(=O)Nc4ccc(S(=O)(=O)NC5CCCC5)cc4)ncnc32)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C27H34N8O7S/c1-4-28-24(36)20-19-21(42-27(2,3)41-19)25(40-20)35-14-31-18-22(29-13-30-23(18)35)33-26(37)32-15-9-11-17(12-10-15)43(38,39)34-16-7-5-6-8-16/h9-14,16,19-21,25,34H,4-8H2,1-3H3,(H,28,36)(H2,29,30,32,33,37)/t19-,20+,21-,25-/m1/s1 |
| InChIKey | CVSOEMKHQMVXFV-FBROZUCGSA-N |
| XLogP | 2.24 |
| TPSA | 187.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.69 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |