C19H21N5O6S — CID 67165105
N-[9-[(3aS,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]benzenesulfonamide (PubChem CID 67165105) has the molecular formula C19H21N5O6S and a molecular weight of 447.47 g/mol. Its IUPAC name is N-[9-[(3aS,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]benzenesulfonamide.
| Compound Name | N-[9-[(3aS,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67165105 |
| Molecular Formula | C19H21N5O6S |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | N-[9-[(3aS,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]benzenesulfonamide |
| SMILES | CC1(C)O[C@H]2[C@H](O1)[C@@H](CO)O[C@H]2n1cnc2c(NS(=O)(=O)c3ccccc3)ncnc21 |
| InChI | InChI=1S/C19H21N5O6S/c1-19(2)29-14-12(8-25)28-18(15(14)30-19)24-10-22-13-16(20-9-21-17(13)24)23-31(26,27)11-6-4-3-5-7-11/h3-7,9-10,12,14-15,18,25H,8H2,1-2H3,(H,20,21,23)/t12-,14-,15+,18-/m1/s1 |
| InChIKey | MDMCLARRLQWZKN-LJGDNWOOSA-N |
| XLogP | 1.04 |
| TPSA | 137.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |