C19H22N6O8S2 — CID 87293259
[(3aR,4R,6R,6aR)-4-[6-(benzenesulfonamido)purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl sulfamate (PubChem CID 87293259) has the molecular formula C19H22N6O8S2 and a molecular weight of 526.55 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-4-[6-(benzenesulfonamido)purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl sulfamate.
| Compound Name | [(3aR,4R,6R,6aR)-4-[6-(benzenesulfonamido)purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl sulfamate |
|---|---|
| PubChem CID | 87293259 |
| Molecular Formula | C19H22N6O8S2 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | [(3aR,4R,6R,6aR)-4-[6-(benzenesulfonamido)purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl sulfamate |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](COS(N)(=O)=O)O[C@H]2n1cnc2c(NS(=O)(=O)c3ccccc3)ncnc21 |
| InChI | InChI=1S/C19H22N6O8S2/c1-19(2)32-14-12(8-30-35(20,28)29)31-18(15(14)33-19)25-10-23-13-16(21-9-22-17(13)25)24-34(26,27)11-6-4-3-5-7-11/h3-7,9-10,12,14-15,18H,8H2,1-2H3,(H2,20,28,29)(H,21,22,24)/t12-,14-,15-,18-/m1/s1 |
| InChIKey | FYZZDQBQVKLFOY-SCFUHWHPSA-N |
| XLogP | 0.26 |
| TPSA | 186.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |