C15H18N6O6S — CID 140848348
[(4R,6R,6aS)-4-imidazo[2,1-f]purin-3-yl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl sulfamate (PubChem CID 140848348) has the molecular formula C15H18N6O6S and a molecular weight of 410.41 g/mol. Its IUPAC name is [(4R,6R,6aS)-4-imidazo[2,1-f]purin-3-yl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl sulfamate.
| Compound Name | [(4R,6R,6aS)-4-imidazo[2,1-f]purin-3-yl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl sulfamate |
|---|---|
| PubChem CID | 140848348 |
| Molecular Formula | C15H18N6O6S |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | [(4R,6R,6aS)-4-imidazo[2,1-f]purin-3-yl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl sulfamate |
| SMILES | CC1(C)OC2[C@@H](O1)[C@@H](COS(N)(=O)=O)O[C@H]2n1cnc2c1ncn1ccnc21 |
| InChI | InChI=1S/C15H18N6O6S/c1-15(2)26-10-8(5-24-28(16,22)23)25-14(11(10)27-15)21-7-18-9-12-17-3-4-20(12)6-19-13(9)21/h3-4,6-8,10-11,14H,5H2,1-2H3,(H2,16,22,23)/t8-,10+,11?,14-/m1/s1 |
| InChIKey | WWAPWBYFERYBCS-XNZUMOJTSA-N |
| XLogP | -0.28 |
| TPSA | 145.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |