C12H12N5NaO6P — CID 131865007
CID 131865007 (PubChem CID 131865007) has the molecular formula C12H12N5NaO6P and a molecular weight of 376.22 g/mol.
| Compound Name | CID 131865007 |
|---|---|
| PubChem CID | 131865007 |
| Molecular Formula | C12H12N5NaO6P |
| Molecular Weight | 376.22 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | — |
| SMILES | O=P1(O)O[C@@H]2[C@H](O1)[C@@H](CO)O[C@H]2n1cnc2c1ncn1ccnc21.[Na] |
| InChI | InChI=1S/C12H12N5O6P.Na/c18-3-6-8-9(23-24(19,20)22-8)12(21-6)17-5-14-7-10-13-1-2-16(10)4-15-11(7)17;/h1-2,4-6,8-9,12,18H,3H2,(H,19,20);/t6-,8-,9-,12-;/m1./s1 |
| InChIKey | UDOSCLWTVXQDSN-OUTCZKRVSA-N |
| XLogP | -0.53 |
| TPSA | 133.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.22 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|