C22H31N8O6P — CID 89318332
[(4R,6R)-4-[2,6-bis[(2Z)-2-(cyclopentylmethylidene)hydrazinyl]purin-9-yl]-2-hydroxy-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaphosphol-6-yl]methanol (PubChem CID 89318332) has the molecular formula C22H31N8O6P and a molecular weight of 534.51 g/mol. Its IUPAC name is [(4R,6R)-4-[2,6-bis[(2Z)-2-(cyclopentylmethylidene)hydrazinyl]purin-9-yl]-2-hydroxy-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaphosphol-6-yl]methanol.
| Compound Name | [(4R,6R)-4-[2,6-bis[(2Z)-2-(cyclopentylmethylidene)hydrazinyl]purin-9-yl]-2-hydroxy-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaphosphol-6-yl]methanol |
|---|---|
| PubChem CID | 89318332 |
| Molecular Formula | C22H31N8O6P |
| Molecular Weight | 534.51 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | [(4R,6R)-4-[2,6-bis[(2Z)-2-(cyclopentylmethylidene)hydrazinyl]purin-9-yl]-2-hydroxy-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaphosphol-6-yl]methanol |
| SMILES | O=P1(O)OC2C(O1)[C@@H](CO)O[C@H]2n1cnc2c(N/N=C\C3CCCC3)nc(N/N=C\C3CCCC3)nc21 |
| InChI | InChI=1S/C22H31N8O6P/c31-11-15-17-18(36-37(32,33)35-17)21(34-15)30-12-23-16-19(28-24-9-13-5-1-2-6-13)26-22(27-20(16)30)29-25-10-14-7-3-4-8-14/h9-10,12-15,17-18,21,31H,1-8,11H2,(H,32,33)(H2,26,27,28,29)/b24-9-,25-10-/t15-,17?,18?,21-/m1/s1 |
| InChIKey | CUNLHTFHRIWBBT-SWMNJHDDSA-N |
| XLogP | 2.78 |
| TPSA | 177.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|