C17H23N7O4 — CID 22617603
2-[6-amino-2-[(2E)-2-(cyclohex-3-en-1-ylmethylidene)hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 22617603) has the molecular formula C17H23N7O4 and a molecular weight of 389.42 g/mol. Its IUPAC name is 2-[6-amino-2-[(2E)-2-(cyclohex-3-en-1-ylmethylidene)hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | 2-[6-amino-2-[(2E)-2-(cyclohex-3-en-1-ylmethylidene)hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 22617603 |
| Molecular Formula | C17H23N7O4 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 2-[6-amino-2-[(2E)-2-(cyclohex-3-en-1-ylmethylidene)hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1nc(N/N=C/C2CC=CCC2)nc2c1ncn2C1OC(CO)C(O)C1O |
| InChI | InChI=1S/C17H23N7O4/c18-14-11-15(22-17(21-14)23-20-6-9-4-2-1-3-5-9)24(8-19-11)16-13(27)12(26)10(7-25)28-16/h1-2,6,8-10,12-13,16,25-27H,3-5,7H2,(H3,18,21,22,23)/b20-6+ |
| InChIKey | XWNBDTFQJKIERB-CGOBSMCZSA-N |
| XLogP | -0.23 |
| TPSA | 163.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|