C27H42ClN5O4 — CID 171471163
[(3aR,4R,6R,6aR)-2,2-diheptyl-4-imidazo[2,1-f]purin-3-yl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol;hydrochloride (PubChem CID 171471163) has the molecular formula C27H42ClN5O4 and a molecular weight of 536.12 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-2,2-diheptyl-4-imidazo[2,1-f]purin-3-yl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol;hydrochloride.
| Compound Name | [(3aR,4R,6R,6aR)-2,2-diheptyl-4-imidazo[2,1-f]purin-3-yl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol;hydrochloride |
|---|---|
| PubChem CID | 171471163 |
| Molecular Formula | C27H42ClN5O4 |
| Molecular Weight | 536.12 g/mol |
| Exact Mass | 535.29 |
| IUPAC Name | [(3aR,4R,6R,6aR)-2,2-diheptyl-4-imidazo[2,1-f]purin-3-yl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol;hydrochloride |
| SMILES | CCCCCCCC1(CCCCCCC)O[C@@H]2[C@H](O1)[C@@H](CO)O[C@H]2n1cnc2c1ncn1ccnc21.Cl |
| InChI | InChI=1S/C27H41N5O4.ClH/c1-3-5-7-9-11-13-27(14-12-10-8-6-4-2)35-22-20(17-33)34-26(23(22)36-27)32-19-29-21-24-28-15-16-31(24)18-30-25(21)32;/h15-16,18-20,22-23,26,33H,3-14,17H2,1-2H3;1H/t20-,22-,23-,26-;/m1./s1 |
| InChIKey | NVJURLSDSVPCOR-DGUBOJIQSA-N |
| XLogP | 5.59 |
| TPSA | 95.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.12 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|