C20H21ClN6O8S — CID 25041917
[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl N-(4-chloro-2-hydroxybenzoyl)sulfamate (PubChem CID 25041917) has the molecular formula C20H21ClN6O8S and a molecular weight of 540.94 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl N-(4-chloro-2-hydroxybenzoyl)sulfamate.
| Compound Name | [(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl N-(4-chloro-2-hydroxybenzoyl)sulfamate |
|---|---|
| PubChem CID | 25041917 |
| Molecular Formula | C20H21ClN6O8S |
| Molecular Weight | 540.94 g/mol |
| Exact Mass | 540.08 |
| IUPAC Name | [(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl N-(4-chloro-2-hydroxybenzoyl)sulfamate |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](COS(=O)(=O)NC(=O)c1ccc(Cl)cc1O)O[C@H]2n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C20H21ClN6O8S/c1-20(2)34-14-12(6-32-36(30,31)26-18(29)10-4-3-9(21)5-11(10)28)33-19(15(14)35-20)27-8-25-13-16(22)23-7-24-17(13)27/h3-5,7-8,12,14-15,19,28H,6H2,1-2H3,(H,26,29)(H2,22,23,24)/t12-,14-,15-,19-/m1/s1 |
| InChIKey | ZJVLHQGVAVMZKH-QEPJRFBGSA-N |
| XLogP | 0.88 |
| TPSA | 190.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.94 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |