C21H25N5O6S — CID 87293438
[(3aR,4R,6R,6aR)-2,2-dimethyl-4-[6-(2-phenylethyl)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl sulfamate (PubChem CID 87293438) has the molecular formula C21H25N5O6S and a molecular weight of 475.53 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-2,2-dimethyl-4-[6-(2-phenylethyl)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl sulfamate.
| Compound Name | [(3aR,4R,6R,6aR)-2,2-dimethyl-4-[6-(2-phenylethyl)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl sulfamate |
|---|---|
| PubChem CID | 87293438 |
| Molecular Formula | C21H25N5O6S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | [(3aR,4R,6R,6aR)-2,2-dimethyl-4-[6-(2-phenylethyl)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl sulfamate |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](COS(N)(=O)=O)O[C@H]2n1cnc2c(CCc3ccccc3)ncnc21 |
| InChI | InChI=1S/C21H25N5O6S/c1-21(2)31-17-15(10-29-33(22,27)28)30-20(18(17)32-21)26-12-25-16-14(23-11-24-19(16)26)9-8-13-6-4-3-5-7-13/h3-7,11-12,15,17-18,20H,8-10H2,1-2H3,(H2,22,27,28)/t15-,17-,18-,20-/m1/s1 |
| InChIKey | WHDFROBMYDMQCO-DLVXIWMQSA-N |
| XLogP | 1.25 |
| TPSA | 140.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |